About 5-[(1R)-1-methoxyethyl]-2-propan-2-yl-5-prop-2-enyl-1,3-dioxane
5-[(1R)-1-methoxyethyl]-2-propan-2-yl-5-prop-2-enyl-1,3-dioxane (PubChem CID 5360716) has the molecular formula C13H24O3
and a molecular weight of 228.33 g/mol. Its IUPAC name is 5-[(1R)-1-methoxyethyl]-2-propan-2-yl-5-prop-2-enyl-1,3-dioxane.
Molecular Properties
| Compound Name | 5-[(1R)-1-methoxyethyl]-2-propan-2-yl-5-prop-2-enyl-1,3-dioxane |
| PubChem CID | 5360716 |
| Molecular Formula | C13H24O3 |
| Molecular Weight | 228.33 g/mol |
| Exact Mass | 228.17 |
| IUPAC Name | 5-[(1R)-1-methoxyethyl]-2-propan-2-yl-5-prop-2-enyl-1,3-dioxane |
| SMILES | C=CCC1([C@@H](C)OC)COC(C(C)C)OC1 |
| InChI | InChI=1S/C13H24O3/c1-6-7-13(11(4)14-5)8-15-12(10(2)3)16-9-13/h6,10-12H,1,7-9H2,2-5H3/t11-,12?,13?/m1/s1 |
| InChIKey | PULPVVBVJILRKY-PNESKVBLSA-N |
| XLogP | 2.61 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.33 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-[(1R)-1-methoxyethyl]-2-propan-2-yl-5-prop-2-enyl-1,3-dioxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(1R)-1-methoxyethyl]-2-propan-2-yl-5-prop-2-enyl-1,3-dioxane?
The IUPAC name of 5-[(1R)-1-methoxyethyl]-2-propan-2-yl-5-prop-2-enyl-1,3-dioxane (CID 5360716) is 5-[(1R)-1-methoxyethyl]-2-propan-2-yl-5-prop-2-enyl-1,3-dioxane.
What is the SMILES notation for 5-[(1R)-1-methoxyethyl]-2-propan-2-yl-5-prop-2-enyl-1,3-dioxane?
The canonical SMILES for 5-[(1R)-1-methoxyethyl]-2-propan-2-yl-5-prop-2-enyl-1,3-dioxane is C=CCC1([C@@H](C)OC)COC(C(C)C)OC1.
What is the InChIKey of 5-[(1R)-1-methoxyethyl]-2-propan-2-yl-5-prop-2-enyl-1,3-dioxane?
The InChIKey is PULPVVBVJILRKY-PNESKVBLSA-N. The full InChI is InChI=1S/C13H24O3/c1-6-7-13(11(4)14-5)8-15-12(10(2)3)16-9-13/h6,10-12H,1,7-9H2,2-5H3/t11-,12?,13?/m1/s1.
What are the key properties of 5-[(1R)-1-methoxyethyl]-2-propan-2-yl-5-prop-2-enyl-1,3-dioxane?
5-[(1R)-1-methoxyethyl]-2-propan-2-yl-5-prop-2-enyl-1,3-dioxane has a molecular weight of 228.33 g/mol, XLogP of 2.61, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(1R)-1-methoxyethyl]-2-propan-2-yl-5-prop-2-enyl-1,3-dioxane is sourced from PubChem (CID 5360716), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).