About (Z)-N-(2,4,6-trichlorophenyl)benzenecarbohydrazonoyl chloride
(Z)-N-(2,4,6-trichlorophenyl)benzenecarbohydrazonoyl chloride (PubChem CID 5360800) has the molecular formula C13H8Cl4N2
and a molecular weight of 334.03 g/mol. Its IUPAC name is (Z)-N-(2,4,6-trichlorophenyl)benzenecarbohydrazonoyl chloride.
Molecular Properties
| Compound Name | (Z)-N-(2,4,6-trichlorophenyl)benzenecarbohydrazonoyl chloride |
| PubChem CID | 5360800 |
| Molecular Formula | C13H8Cl4N2 |
| Molecular Weight | 334.03 g/mol |
| Exact Mass | 331.94 |
| IUPAC Name | (Z)-N-(2,4,6-trichlorophenyl)benzenecarbohydrazonoyl chloride |
| SMILES | Cl/C(=N\Nc1c(Cl)cc(Cl)cc1Cl)c1ccccc1 |
| InChI | InChI=1S/C13H8Cl4N2/c14-9-6-10(15)12(11(16)7-9)18-19-13(17)8-4-2-1-3-5-8/h1-7,18H/b19-13- |
| InChIKey | QVMATSPQIBFRPZ-UYRXBGFRSA-N |
| XLogP | 5.66 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 334.03 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (Z)-N-(2,4,6-trichlorophenyl)benzenecarbohydrazonoyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-N-(2,4,6-trichlorophenyl)benzenecarbohydrazonoyl chloride?
The IUPAC name of (Z)-N-(2,4,6-trichlorophenyl)benzenecarbohydrazonoyl chloride (CID 5360800) is (Z)-N-(2,4,6-trichlorophenyl)benzenecarbohydrazonoyl chloride.
What is the SMILES notation for (Z)-N-(2,4,6-trichlorophenyl)benzenecarbohydrazonoyl chloride?
The canonical SMILES for (Z)-N-(2,4,6-trichlorophenyl)benzenecarbohydrazonoyl chloride is Cl/C(=N\Nc1c(Cl)cc(Cl)cc1Cl)c1ccccc1.
What is the InChIKey of (Z)-N-(2,4,6-trichlorophenyl)benzenecarbohydrazonoyl chloride?
The InChIKey is QVMATSPQIBFRPZ-UYRXBGFRSA-N. The full InChI is InChI=1S/C13H8Cl4N2/c14-9-6-10(15)12(11(16)7-9)18-19-13(17)8-4-2-1-3-5-8/h1-7,18H/b19-13-.
What are the key properties of (Z)-N-(2,4,6-trichlorophenyl)benzenecarbohydrazonoyl chloride?
(Z)-N-(2,4,6-trichlorophenyl)benzenecarbohydrazonoyl chloride has a molecular weight of 334.03 g/mol, XLogP of 5.66, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-N-(2,4,6-trichlorophenyl)benzenecarbohydrazonoyl chloride is sourced from PubChem (CID 5360800), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).