About 3,4-dihydroxyoxolan-2-one
3,4-dihydroxyoxolan-2-one (PubChem CID 536124) has the molecular formula C4H6O4
and a molecular weight of 118.09 g/mol. Its IUPAC name is 3,4-dihydroxyoxolan-2-one.
Molecular Properties
| Compound Name | 3,4-dihydroxyoxolan-2-one |
| PubChem CID | 536124 |
| Molecular Formula | C4H6O4 |
| Molecular Weight | 118.09 g/mol |
| Exact Mass | 118.03 |
| IUPAC Name | 3,4-dihydroxyoxolan-2-one |
| SMILES | O=C1OCC(O)C1O |
| InChI | InChI=1S/C4H6O4/c5-2-1-8-4(7)3(2)6/h2-3,5-6H,1H2 |
| InChIKey | SGMJBNSHAZVGMC-UHFFFAOYSA-N |
| XLogP | -1.74 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 118.09 |
| LogP ≤ 5 | -1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3,4-dihydroxyoxolan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-dihydroxyoxolan-2-one?
The IUPAC name of 3,4-dihydroxyoxolan-2-one (CID 536124) is 3,4-dihydroxyoxolan-2-one.
What is the SMILES notation for 3,4-dihydroxyoxolan-2-one?
The canonical SMILES for 3,4-dihydroxyoxolan-2-one is O=C1OCC(O)C1O.
What is the InChIKey of 3,4-dihydroxyoxolan-2-one?
The InChIKey is SGMJBNSHAZVGMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6O4/c5-2-1-8-4(7)3(2)6/h2-3,5-6H,1H2.
What are the key properties of 3,4-dihydroxyoxolan-2-one?
3,4-dihydroxyoxolan-2-one has a molecular weight of 118.09 g/mol, XLogP of -1.74, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dihydroxyoxolan-2-one is sourced from PubChem (CID 536124), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).