C12H12F6O2 — CID 536170
8,9,9,10,10,11-hexafluoro-4,4-dimethyl-3,5-dioxatetracyclo[5.4.1.02,6.08,11]dodecane (PubChem CID 536170) has the molecular formula C12H12F6O2 and a molecular weight of 302.21 g/mol. Its IUPAC name is 8,9,9,10,10,11-hexafluoro-4,4-dimethyl-3,5-dioxatetracyclo[5.4.1.02,6.08,11]dodecane.
| Compound Name | 8,9,9,10,10,11-hexafluoro-4,4-dimethyl-3,5-dioxatetracyclo[5.4.1.02,6.08,11]dodecane |
|---|---|
| PubChem CID | 536170 |
| Molecular Formula | C12H12F6O2 |
| Molecular Weight | 302.21 g/mol |
| Exact Mass | 302.07 |
| IUPAC Name | 8,9,9,10,10,11-hexafluoro-4,4-dimethyl-3,5-dioxatetracyclo[5.4.1.02,6.08,11]dodecane |
| SMILES | CC1(C)OC2C(O1)C1CC2C2(F)C(F)(F)C(F)(F)C12F |
| InChI | InChI=1S/C12H12F6O2/c1-8(2)19-6-4-3-5(7(6)20-8)10(14)9(4,13)11(15,16)12(10,17)18/h4-7H,3H2,1-2H3 |
| InChIKey | SSTAOBYYFVDWJB-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.21 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|