About N-benzyl-3-chloro-2,2-dimethyl-1-phenylpropan-1-imine
N-benzyl-3-chloro-2,2-dimethyl-1-phenylpropan-1-imine (PubChem CID 536176) has the molecular formula C18H20ClN
and a molecular weight of 285.82 g/mol. Its IUPAC name is N-benzyl-3-chloro-2,2-dimethyl-1-phenylpropan-1-imine.
Molecular Properties
| Compound Name | N-benzyl-3-chloro-2,2-dimethyl-1-phenylpropan-1-imine |
| PubChem CID | 536176 |
| Molecular Formula | C18H20ClN |
| Molecular Weight | 285.82 g/mol |
| Exact Mass | 285.13 |
| IUPAC Name | N-benzyl-3-chloro-2,2-dimethyl-1-phenylpropan-1-imine |
| SMILES | CC(C)(CCl)/C(=N/Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H20ClN/c1-18(2,14-19)17(16-11-7-4-8-12-16)20-13-15-9-5-3-6-10-15/h3-12H,13-14H2,1-2H3/b20-17+ |
| InChIKey | SNROAENGAQRUKJ-LVZFUZTISA-N |
| XLogP | 4.94 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.82 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-benzyl-3-chloro-2,2-dimethyl-1-phenylpropan-1-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzyl-3-chloro-2,2-dimethyl-1-phenylpropan-1-imine?
The IUPAC name of N-benzyl-3-chloro-2,2-dimethyl-1-phenylpropan-1-imine (CID 536176) is N-benzyl-3-chloro-2,2-dimethyl-1-phenylpropan-1-imine.
What is the SMILES notation for N-benzyl-3-chloro-2,2-dimethyl-1-phenylpropan-1-imine?
The canonical SMILES for N-benzyl-3-chloro-2,2-dimethyl-1-phenylpropan-1-imine is CC(C)(CCl)/C(=N/Cc1ccccc1)c1ccccc1.
What is the InChIKey of N-benzyl-3-chloro-2,2-dimethyl-1-phenylpropan-1-imine?
The InChIKey is SNROAENGAQRUKJ-LVZFUZTISA-N. The full InChI is InChI=1S/C18H20ClN/c1-18(2,14-19)17(16-11-7-4-8-12-16)20-13-15-9-5-3-6-10-15/h3-12H,13-14H2,1-2H3/b20-17+.
What are the key properties of N-benzyl-3-chloro-2,2-dimethyl-1-phenylpropan-1-imine?
N-benzyl-3-chloro-2,2-dimethyl-1-phenylpropan-1-imine has a molecular weight of 285.82 g/mol, XLogP of 4.94, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzyl-3-chloro-2,2-dimethyl-1-phenylpropan-1-imine is sourced from PubChem (CID 536176), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).