About (E)-1-(2,4-dichlorophenyl)-N-methoxy-2-pyridin-3-ylethanimine
(E)-1-(2,4-dichlorophenyl)-N-methoxy-2-pyridin-3-ylethanimine (PubChem CID 5362131) has the molecular formula C14H12Cl2N2O
and a molecular weight of 295.17 g/mol. Its IUPAC name is (E)-1-(2,4-dichlorophenyl)-N-methoxy-2-pyridin-3-ylethanimine.
Molecular Properties
| Compound Name | (E)-1-(2,4-dichlorophenyl)-N-methoxy-2-pyridin-3-ylethanimine |
| PubChem CID | 5362131 |
| Molecular Formula | C14H12Cl2N2O |
| Molecular Weight | 295.17 g/mol |
| Exact Mass | 294.03 |
| IUPAC Name | (E)-1-(2,4-dichlorophenyl)-N-methoxy-2-pyridin-3-ylethanimine |
| SMILES | CO/N=C(\Cc1cccnc1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C14H12Cl2N2O/c1-19-18-14(7-10-3-2-6-17-9-10)12-5-4-11(15)8-13(12)16/h2-6,8-9H,7H2,1H3/b18-14+ |
| InChIKey | CKPCAYZTYMHQEX-NBVRZTHBSA-N |
| XLogP | 3.98 |
| TPSA | 34.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.17 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (E)-1-(2,4-dichlorophenyl)-N-methoxy-2-pyridin-3-ylethanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-1-(2,4-dichlorophenyl)-N-methoxy-2-pyridin-3-ylethanimine?
The IUPAC name of (E)-1-(2,4-dichlorophenyl)-N-methoxy-2-pyridin-3-ylethanimine (CID 5362131) is (E)-1-(2,4-dichlorophenyl)-N-methoxy-2-pyridin-3-ylethanimine.
What is the SMILES notation for (E)-1-(2,4-dichlorophenyl)-N-methoxy-2-pyridin-3-ylethanimine?
The canonical SMILES for (E)-1-(2,4-dichlorophenyl)-N-methoxy-2-pyridin-3-ylethanimine is CO/N=C(\Cc1cccnc1)c1ccc(Cl)cc1Cl.
What is the InChIKey of (E)-1-(2,4-dichlorophenyl)-N-methoxy-2-pyridin-3-ylethanimine?
The InChIKey is CKPCAYZTYMHQEX-NBVRZTHBSA-N. The full InChI is InChI=1S/C14H12Cl2N2O/c1-19-18-14(7-10-3-2-6-17-9-10)12-5-4-11(15)8-13(12)16/h2-6,8-9H,7H2,1H3/b18-14+.
What are the key properties of (E)-1-(2,4-dichlorophenyl)-N-methoxy-2-pyridin-3-ylethanimine?
(E)-1-(2,4-dichlorophenyl)-N-methoxy-2-pyridin-3-ylethanimine has a molecular weight of 295.17 g/mol, XLogP of 3.98, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-1-(2,4-dichlorophenyl)-N-methoxy-2-pyridin-3-ylethanimine is sourced from PubChem (CID 5362131), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).