About [(E)-6,7-dihydro-5H-1-benzothiophen-4-ylideneamino] N-methylcarbamate
[(E)-6,7-dihydro-5H-1-benzothiophen-4-ylideneamino] N-methylcarbamate (PubChem CID 5362283) has the molecular formula C10H12N2O2S
and a molecular weight of 224.28 g/mol. Its IUPAC name is [(E)-6,7-dihydro-5H-1-benzothiophen-4-ylideneamino] N-methylcarbamate.
Molecular Properties
| Compound Name | [(E)-6,7-dihydro-5H-1-benzothiophen-4-ylideneamino] N-methylcarbamate |
| PubChem CID | 5362283 |
| Molecular Formula | C10H12N2O2S |
| Molecular Weight | 224.28 g/mol |
| Exact Mass | 224.06 |
| IUPAC Name | [(E)-6,7-dihydro-5H-1-benzothiophen-4-ylideneamino] N-methylcarbamate |
| SMILES | CNC(=O)O/N=C1\CCCc2sccc21 |
| InChI | InChI=1S/C10H12N2O2S/c1-11-10(13)14-12-8-3-2-4-9-7(8)5-6-15-9/h5-6H,2-4H2,1H3,(H,11,13)/b12-8+ |
| InChIKey | BHNRJPMTOUSDTC-XYOKQWHBSA-N |
| XLogP | 2.14 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.28 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [(E)-6,7-dihydro-5H-1-benzothiophen-4-ylideneamino] N-methylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-6,7-dihydro-5H-1-benzothiophen-4-ylideneamino] N-methylcarbamate?
The IUPAC name of [(E)-6,7-dihydro-5H-1-benzothiophen-4-ylideneamino] N-methylcarbamate (CID 5362283) is [(E)-6,7-dihydro-5H-1-benzothiophen-4-ylideneamino] N-methylcarbamate.
What is the SMILES notation for [(E)-6,7-dihydro-5H-1-benzothiophen-4-ylideneamino] N-methylcarbamate?
The canonical SMILES for [(E)-6,7-dihydro-5H-1-benzothiophen-4-ylideneamino] N-methylcarbamate is CNC(=O)O/N=C1\CCCc2sccc21.
What is the InChIKey of [(E)-6,7-dihydro-5H-1-benzothiophen-4-ylideneamino] N-methylcarbamate?
The InChIKey is BHNRJPMTOUSDTC-XYOKQWHBSA-N. The full InChI is InChI=1S/C10H12N2O2S/c1-11-10(13)14-12-8-3-2-4-9-7(8)5-6-15-9/h5-6H,2-4H2,1H3,(H,11,13)/b12-8+.
What are the key properties of [(E)-6,7-dihydro-5H-1-benzothiophen-4-ylideneamino] N-methylcarbamate?
[(E)-6,7-dihydro-5H-1-benzothiophen-4-ylideneamino] N-methylcarbamate has a molecular weight of 224.28 g/mol, XLogP of 2.14, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-6,7-dihydro-5H-1-benzothiophen-4-ylideneamino] N-methylcarbamate is sourced from PubChem (CID 5362283), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).