C6H10O2 — CID 536240
1-methyl-2,3-dioxabicyclo[2.2.1]heptane (PubChem CID 536240) has the molecular formula C6H10O2 and a molecular weight of 114.14 g/mol. Its IUPAC name is 1-methyl-2,3-dioxabicyclo[2.2.1]heptane.
| Compound Name | 1-methyl-2,3-dioxabicyclo[2.2.1]heptane |
|---|---|
| PubChem CID | 536240 |
| Molecular Formula | C6H10O2 |
| Molecular Weight | 114.14 g/mol |
| Exact Mass | 114.07 |
| IUPAC Name | 1-methyl-2,3-dioxabicyclo[2.2.1]heptane |
| SMILES | CC12CCC(C1)OO2 |
| InChI | InChI=1S/C6H10O2/c1-6-3-2-5(4-6)7-8-6/h5H,2-4H2,1H3 |
| InChIKey | GAULEDMYQLCHDF-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 114.14 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|