About 1-hydroxynonan-3-one
1-hydroxynonan-3-one (PubChem CID 5362570) has the molecular formula C9H18O2
and a molecular weight of 158.24 g/mol. Its IUPAC name is 1-hydroxynonan-3-one.
Molecular Properties
| Compound Name | 1-hydroxynonan-3-one |
| PubChem CID | 5362570 |
| Molecular Formula | C9H18O2 |
| Molecular Weight | 158.24 g/mol |
| Exact Mass | 158.13 |
| IUPAC Name | 1-hydroxynonan-3-one |
| SMILES | CCCCCCC(=O)CCO |
| InChI | InChI=1S/C9H18O2/c1-2-3-4-5-6-9(11)7-8-10/h10H,2-8H2,1H3 |
| InChIKey | KCTDZLVBGWXNSQ-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.24 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-hydroxynonan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-hydroxynonan-3-one?
The IUPAC name of 1-hydroxynonan-3-one (CID 5362570) is 1-hydroxynonan-3-one.
What is the SMILES notation for 1-hydroxynonan-3-one?
The canonical SMILES for 1-hydroxynonan-3-one is CCCCCCC(=O)CCO.
What is the InChIKey of 1-hydroxynonan-3-one?
The InChIKey is KCTDZLVBGWXNSQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18O2/c1-2-3-4-5-6-9(11)7-8-10/h10H,2-8H2,1H3.
What are the key properties of 1-hydroxynonan-3-one?
1-hydroxynonan-3-one has a molecular weight of 158.24 g/mol, XLogP of 1.91, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-hydroxynonan-3-one is sourced from PubChem (CID 5362570), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).