About propyl (2E,4E)-deca-2,4-dienoate
propyl (2E,4E)-deca-2,4-dienoate (PubChem CID 5362592) has the molecular formula C13H22O2
and a molecular weight of 210.32 g/mol. Its IUPAC name is propyl (2E,4E)-deca-2,4-dienoate.
Molecular Properties
| Compound Name | propyl (2E,4E)-deca-2,4-dienoate |
| PubChem CID | 5362592 |
| Molecular Formula | C13H22O2 |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.16 |
| IUPAC Name | propyl (2E,4E)-deca-2,4-dienoate |
| SMILES | CCCCC/C=C/C=C/C(=O)OCCC |
| InChI | InChI=1S/C13H22O2/c1-3-5-6-7-8-9-10-11-13(14)15-12-4-2/h8-11H,3-7,12H2,1-2H3/b9-8+,11-10+ |
| InChIKey | RKDOXCGYGLYOBV-BNFZFUHLSA-N |
| XLogP | 3.63 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze propyl (2E,4E)-deca-2,4-dienoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propyl (2E,4E)-deca-2,4-dienoate?
The IUPAC name of propyl (2E,4E)-deca-2,4-dienoate (CID 5362592) is propyl (2E,4E)-deca-2,4-dienoate.
What is the SMILES notation for propyl (2E,4E)-deca-2,4-dienoate?
The canonical SMILES for propyl (2E,4E)-deca-2,4-dienoate is CCCCC/C=C/C=C/C(=O)OCCC.
What is the InChIKey of propyl (2E,4E)-deca-2,4-dienoate?
The InChIKey is RKDOXCGYGLYOBV-BNFZFUHLSA-N. The full InChI is InChI=1S/C13H22O2/c1-3-5-6-7-8-9-10-11-13(14)15-12-4-2/h8-11H,3-7,12H2,1-2H3/b9-8+,11-10+.
What are the key properties of propyl (2E,4E)-deca-2,4-dienoate?
propyl (2E,4E)-deca-2,4-dienoate has a molecular weight of 210.32 g/mol, XLogP of 3.63, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for propyl (2E,4E)-deca-2,4-dienoate is sourced from PubChem (CID 5362592), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).