About propan-2-yl (2E)-nona-2,8-dienoate
propan-2-yl (2E)-nona-2,8-dienoate (PubChem CID 5362671) has the molecular formula C12H20O2
and a molecular weight of 196.29 g/mol. Its IUPAC name is propan-2-yl (2E)-nona-2,8-dienoate.
Molecular Properties
| Compound Name | propan-2-yl (2E)-nona-2,8-dienoate |
| PubChem CID | 5362671 |
| Molecular Formula | C12H20O2 |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.15 |
| IUPAC Name | propan-2-yl (2E)-nona-2,8-dienoate |
| SMILES | C=CCCCC/C=C/C(=O)OC(C)C |
| InChI | InChI=1S/C12H20O2/c1-4-5-6-7-8-9-10-12(13)14-11(2)3/h4,9-11H,1,5-8H2,2-3H3/b10-9+ |
| InChIKey | VKKSGUARFGQUQV-MDZDMXLPSA-N |
| XLogP | 3.24 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze propan-2-yl (2E)-nona-2,8-dienoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-yl (2E)-nona-2,8-dienoate?
The IUPAC name of propan-2-yl (2E)-nona-2,8-dienoate (CID 5362671) is propan-2-yl (2E)-nona-2,8-dienoate.
What is the SMILES notation for propan-2-yl (2E)-nona-2,8-dienoate?
The canonical SMILES for propan-2-yl (2E)-nona-2,8-dienoate is C=CCCCC/C=C/C(=O)OC(C)C.
What is the InChIKey of propan-2-yl (2E)-nona-2,8-dienoate?
The InChIKey is VKKSGUARFGQUQV-MDZDMXLPSA-N. The full InChI is InChI=1S/C12H20O2/c1-4-5-6-7-8-9-10-12(13)14-11(2)3/h4,9-11H,1,5-8H2,2-3H3/b10-9+.
What are the key properties of propan-2-yl (2E)-nona-2,8-dienoate?
propan-2-yl (2E)-nona-2,8-dienoate has a molecular weight of 196.29 g/mol, XLogP of 3.24, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl (2E)-nona-2,8-dienoate is sourced from PubChem (CID 5362671), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).