About [(Z)-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene)amino]urea
[(Z)-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene)amino]urea (PubChem CID 5362684) has the molecular formula C11H19N3O
and a molecular weight of 209.29 g/mol. Its IUPAC name is [(Z)-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene)amino]urea.
Molecular Properties
| Compound Name | [(Z)-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene)amino]urea |
| PubChem CID | 5362684 |
| Molecular Formula | C11H19N3O |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.15 |
| IUPAC Name | [(Z)-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene)amino]urea |
| SMILES | CC12CCC(C/C1=N/NC(N)=O)C2(C)C |
| InChI | InChI=1S/C11H19N3O/c1-10(2)7-4-5-11(10,3)8(6-7)13-14-9(12)15/h7H,4-6H2,1-3H3,(H3,12,14,15)/b13-8- |
| InChIKey | QCEFOIDJHJPYIB-JYRVWZFOSA-N |
| XLogP | 1.86 |
| TPSA | 67.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [(Z)-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene)amino]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(Z)-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene)amino]urea?
The IUPAC name of [(Z)-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene)amino]urea (CID 5362684) is [(Z)-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene)amino]urea.
What is the SMILES notation for [(Z)-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene)amino]urea?
The canonical SMILES for [(Z)-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene)amino]urea is CC12CCC(C/C1=N/NC(N)=O)C2(C)C.
What is the InChIKey of [(Z)-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene)amino]urea?
The InChIKey is QCEFOIDJHJPYIB-JYRVWZFOSA-N. The full InChI is InChI=1S/C11H19N3O/c1-10(2)7-4-5-11(10,3)8(6-7)13-14-9(12)15/h7H,4-6H2,1-3H3,(H3,12,14,15)/b13-8-.
What are the key properties of [(Z)-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene)amino]urea?
[(Z)-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene)amino]urea has a molecular weight of 209.29 g/mol, XLogP of 1.86, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(Z)-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene)amino]urea is sourced from PubChem (CID 5362684), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).