About diethyl-[(E)-4,5,5-trimethylhex-3-en-3-yl]borane
diethyl-[(E)-4,5,5-trimethylhex-3-en-3-yl]borane (PubChem CID 5362690) has the molecular formula C13H27B
and a molecular weight of 194.17 g/mol. Its IUPAC name is diethyl-[(E)-4,5,5-trimethylhex-3-en-3-yl]borane.
Molecular Properties
| Compound Name | diethyl-[(E)-4,5,5-trimethylhex-3-en-3-yl]borane |
| PubChem CID | 5362690 |
| Molecular Formula | C13H27B |
| Molecular Weight | 194.17 g/mol |
| Exact Mass | 194.22 |
| IUPAC Name | diethyl-[(E)-4,5,5-trimethylhex-3-en-3-yl]borane |
| SMILES | CCB(CC)/C(CC)=C(/C)C(C)(C)C |
| InChI | InChI=1S/C13H27B/c1-8-12(14(9-2)10-3)11(4)13(5,6)7/h8-10H2,1-7H3/b12-11- |
| InChIKey | OHYCPARBXQHUJF-QXMHVHEDSA-N |
| XLogP | 4.83 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.17 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze diethyl-[(E)-4,5,5-trimethylhex-3-en-3-yl]borane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethyl-[(E)-4,5,5-trimethylhex-3-en-3-yl]borane?
The IUPAC name of diethyl-[(E)-4,5,5-trimethylhex-3-en-3-yl]borane (CID 5362690) is diethyl-[(E)-4,5,5-trimethylhex-3-en-3-yl]borane.
What is the SMILES notation for diethyl-[(E)-4,5,5-trimethylhex-3-en-3-yl]borane?
The canonical SMILES for diethyl-[(E)-4,5,5-trimethylhex-3-en-3-yl]borane is CCB(CC)/C(CC)=C(/C)C(C)(C)C.
What is the InChIKey of diethyl-[(E)-4,5,5-trimethylhex-3-en-3-yl]borane?
The InChIKey is OHYCPARBXQHUJF-QXMHVHEDSA-N. The full InChI is InChI=1S/C13H27B/c1-8-12(14(9-2)10-3)11(4)13(5,6)7/h8-10H2,1-7H3/b12-11-.
What are the key properties of diethyl-[(E)-4,5,5-trimethylhex-3-en-3-yl]borane?
diethyl-[(E)-4,5,5-trimethylhex-3-en-3-yl]borane has a molecular weight of 194.17 g/mol, XLogP of 4.83, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for diethyl-[(E)-4,5,5-trimethylhex-3-en-3-yl]borane is sourced from PubChem (CID 5362690), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).