About 3-[(E)-tridec-10-enyl]-6,7-dihydro-5H-1,2-benzoxazol-4-one
3-[(E)-tridec-10-enyl]-6,7-dihydro-5H-1,2-benzoxazol-4-one (PubChem CID 5362727) has the molecular formula C20H31NO2
and a molecular weight of 317.47 g/mol. Its IUPAC name is 3-[(E)-tridec-10-enyl]-6,7-dihydro-5H-1,2-benzoxazol-4-one.
Molecular Properties
| Compound Name | 3-[(E)-tridec-10-enyl]-6,7-dihydro-5H-1,2-benzoxazol-4-one |
| PubChem CID | 5362727 |
| Molecular Formula | C20H31NO2 |
| Molecular Weight | 317.47 g/mol |
| Exact Mass | 317.24 |
| IUPAC Name | 3-[(E)-tridec-10-enyl]-6,7-dihydro-5H-1,2-benzoxazol-4-one |
| SMILES | CC/C=C/CCCCCCCCCc1noc2c1C(=O)CCC2 |
| InChI | InChI=1S/C20H31NO2/c1-2-3-4-5-6-7-8-9-10-11-12-14-17-20-18(22)15-13-16-19(20)23-21-17/h3-4H,2,5-16H2,1H3/b4-3+ |
| InChIKey | NDJBAPKQPHPDTE-ONEGZZNKSA-N |
| XLogP | 5.82 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 317.47 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-[(E)-tridec-10-enyl]-6,7-dihydro-5H-1,2-benzoxazol-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(E)-tridec-10-enyl]-6,7-dihydro-5H-1,2-benzoxazol-4-one?
The IUPAC name of 3-[(E)-tridec-10-enyl]-6,7-dihydro-5H-1,2-benzoxazol-4-one (CID 5362727) is 3-[(E)-tridec-10-enyl]-6,7-dihydro-5H-1,2-benzoxazol-4-one.
What is the SMILES notation for 3-[(E)-tridec-10-enyl]-6,7-dihydro-5H-1,2-benzoxazol-4-one?
The canonical SMILES for 3-[(E)-tridec-10-enyl]-6,7-dihydro-5H-1,2-benzoxazol-4-one is CC/C=C/CCCCCCCCCc1noc2c1C(=O)CCC2.
What is the InChIKey of 3-[(E)-tridec-10-enyl]-6,7-dihydro-5H-1,2-benzoxazol-4-one?
The InChIKey is NDJBAPKQPHPDTE-ONEGZZNKSA-N. The full InChI is InChI=1S/C20H31NO2/c1-2-3-4-5-6-7-8-9-10-11-12-14-17-20-18(22)15-13-16-19(20)23-21-17/h3-4H,2,5-16H2,1H3/b4-3+.
What are the key properties of 3-[(E)-tridec-10-enyl]-6,7-dihydro-5H-1,2-benzoxazol-4-one?
3-[(E)-tridec-10-enyl]-6,7-dihydro-5H-1,2-benzoxazol-4-one has a molecular weight of 317.47 g/mol, XLogP of 5.82, 11 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(E)-tridec-10-enyl]-6,7-dihydro-5H-1,2-benzoxazol-4-one is sourced from PubChem (CID 5362727), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).