About methyl (9E,12E)-octadeca-9,12-dienoate
methyl (9E,12E)-octadeca-9,12-dienoate (PubChem CID 5362793) has the molecular formula C19H34O2
and a molecular weight of 294.48 g/mol. Its IUPAC name is methyl (9E,12E)-octadeca-9,12-dienoate.
Molecular Properties
| Compound Name | methyl (9E,12E)-octadeca-9,12-dienoate |
| PubChem CID | 5362793 |
| Molecular Formula | C19H34O2 |
| Molecular Weight | 294.48 g/mol |
| Exact Mass | 294.26 |
| IUPAC Name | methyl (9E,12E)-octadeca-9,12-dienoate |
| SMILES | CCCCC/C=C/C/C=C/CCCCCCCC(=O)OC |
| InChI | InChI=1S/C19H34O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19(20)21-2/h7-8,10-11H,3-6,9,12-18H2,1-2H3/b8-7+,11-10+ |
| InChIKey | WTTJVINHCBCLGX-ZDVGBALWSA-N |
| XLogP | 5.97 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 294.48 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze methyl (9E,12E)-octadeca-9,12-dienoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (9E,12E)-octadeca-9,12-dienoate?
The IUPAC name of methyl (9E,12E)-octadeca-9,12-dienoate (CID 5362793) is methyl (9E,12E)-octadeca-9,12-dienoate.
What is the SMILES notation for methyl (9E,12E)-octadeca-9,12-dienoate?
The canonical SMILES for methyl (9E,12E)-octadeca-9,12-dienoate is CCCCC/C=C/C/C=C/CCCCCCCC(=O)OC.
What is the InChIKey of methyl (9E,12E)-octadeca-9,12-dienoate?
The InChIKey is WTTJVINHCBCLGX-ZDVGBALWSA-N. The full InChI is InChI=1S/C19H34O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19(20)21-2/h7-8,10-11H,3-6,9,12-18H2,1-2H3/b8-7+,11-10+.
What are the key properties of methyl (9E,12E)-octadeca-9,12-dienoate?
methyl (9E,12E)-octadeca-9,12-dienoate has a molecular weight of 294.48 g/mol, XLogP of 5.97, 14 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (9E,12E)-octadeca-9,12-dienoate is sourced from PubChem (CID 5362793), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).