About (6Z)-6,10-dimethyl-3-propan-2-ylcyclodec-6-ene-1,4-dione
(6Z)-6,10-dimethyl-3-propan-2-ylcyclodec-6-ene-1,4-dione (PubChem CID 5362828) has the molecular formula C15H24O2
and a molecular weight of 236.35 g/mol. Its IUPAC name is (6Z)-6,10-dimethyl-3-propan-2-ylcyclodec-6-ene-1,4-dione.
Molecular Properties
| Compound Name | (6Z)-6,10-dimethyl-3-propan-2-ylcyclodec-6-ene-1,4-dione |
| PubChem CID | 5362828 |
| Molecular Formula | C15H24O2 |
| Molecular Weight | 236.35 g/mol |
| Exact Mass | 236.18 |
| IUPAC Name | (6Z)-6,10-dimethyl-3-propan-2-ylcyclodec-6-ene-1,4-dione |
| SMILES | C/C1=C/CCC(C)C(=O)CC(C(C)C)C(=O)C1 |
| InChI | InChI=1S/C15H24O2/c1-10(2)13-9-14(16)12(4)7-5-6-11(3)8-15(13)17/h6,10,12-13H,5,7-9H2,1-4H3/b11-6- |
| InChIKey | KDPFMRXIVDLQKX-WDZFZDKYSA-N |
| XLogP | 3.55 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.35 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (6Z)-6,10-dimethyl-3-propan-2-ylcyclodec-6-ene-1,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6Z)-6,10-dimethyl-3-propan-2-ylcyclodec-6-ene-1,4-dione?
The IUPAC name of (6Z)-6,10-dimethyl-3-propan-2-ylcyclodec-6-ene-1,4-dione (CID 5362828) is (6Z)-6,10-dimethyl-3-propan-2-ylcyclodec-6-ene-1,4-dione.
What is the SMILES notation for (6Z)-6,10-dimethyl-3-propan-2-ylcyclodec-6-ene-1,4-dione?
The canonical SMILES for (6Z)-6,10-dimethyl-3-propan-2-ylcyclodec-6-ene-1,4-dione is C/C1=C/CCC(C)C(=O)CC(C(C)C)C(=O)C1.
What is the InChIKey of (6Z)-6,10-dimethyl-3-propan-2-ylcyclodec-6-ene-1,4-dione?
The InChIKey is KDPFMRXIVDLQKX-WDZFZDKYSA-N. The full InChI is InChI=1S/C15H24O2/c1-10(2)13-9-14(16)12(4)7-5-6-11(3)8-15(13)17/h6,10,12-13H,5,7-9H2,1-4H3/b11-6-.
What are the key properties of (6Z)-6,10-dimethyl-3-propan-2-ylcyclodec-6-ene-1,4-dione?
(6Z)-6,10-dimethyl-3-propan-2-ylcyclodec-6-ene-1,4-dione has a molecular weight of 236.35 g/mol, XLogP of 3.55, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (6Z)-6,10-dimethyl-3-propan-2-ylcyclodec-6-ene-1,4-dione is sourced from PubChem (CID 5362828), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).