C12H20O3 — CID 5363088
ethyl (E)-2-acetyl-2,4-dimethylhex-4-enoate (PubChem CID 5363088) has the molecular formula C12H20O3 and a molecular weight of 212.29 g/mol. Its IUPAC name is ethyl (E)-2-acetyl-2,4-dimethylhex-4-enoate.
| Compound Name | ethyl (E)-2-acetyl-2,4-dimethylhex-4-enoate |
|---|---|
| PubChem CID | 5363088 |
| Molecular Formula | C12H20O3 |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.14 |
| IUPAC Name | ethyl (E)-2-acetyl-2,4-dimethylhex-4-enoate |
| SMILES | C/C=C(\C)CC(C)(C(C)=O)C(=O)OCC |
| InChI | InChI=1S/C12H20O3/c1-6-9(3)8-12(5,10(4)13)11(14)15-7-2/h6H,7-8H2,1-5H3/b9-6+ |
| InChIKey | OFPGNENFBAKLKN-RMKNXTFCSA-N |
| XLogP | 2.50 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|