About [(3E,13Z)-octadeca-3,13-dienyl] acetate
[(3E,13Z)-octadeca-3,13-dienyl] acetate (PubChem CID 5363259) has the molecular formula C20H36O2
and a molecular weight of 308.51 g/mol. Its IUPAC name is [(3E,13Z)-octadeca-3,13-dienyl] acetate.
Molecular Properties
| Compound Name | [(3E,13Z)-octadeca-3,13-dienyl] acetate |
| PubChem CID | 5363259 |
| Molecular Formula | C20H36O2 |
| Molecular Weight | 308.51 g/mol |
| Exact Mass | 308.27 |
| IUPAC Name | [(3E,13Z)-octadeca-3,13-dienyl] acetate |
| SMILES | CCCC/C=C\CCCCCCCC/C=C/CCOC(C)=O |
| InChI | InChI=1S/C20H36O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-22-20(2)21/h6-7,16-17H,3-5,8-15,18-19H2,1-2H3/b7-6-,17-16+ |
| InChIKey | VVJPJXKHBZNADP-ZSTZHTMOSA-N |
| XLogP | 6.36 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 308.51 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(3E,13Z)-octadeca-3,13-dienyl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3E,13Z)-octadeca-3,13-dienyl] acetate?
The IUPAC name of [(3E,13Z)-octadeca-3,13-dienyl] acetate (CID 5363259) is [(3E,13Z)-octadeca-3,13-dienyl] acetate.
What is the SMILES notation for [(3E,13Z)-octadeca-3,13-dienyl] acetate?
The canonical SMILES for [(3E,13Z)-octadeca-3,13-dienyl] acetate is CCCC/C=C\CCCCCCCC/C=C/CCOC(C)=O.
What is the InChIKey of [(3E,13Z)-octadeca-3,13-dienyl] acetate?
The InChIKey is VVJPJXKHBZNADP-ZSTZHTMOSA-N. The full InChI is InChI=1S/C20H36O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-22-20(2)21/h6-7,16-17H,3-5,8-15,18-19H2,1-2H3/b7-6-,17-16+.
What are the key properties of [(3E,13Z)-octadeca-3,13-dienyl] acetate?
[(3E,13Z)-octadeca-3,13-dienyl] acetate has a molecular weight of 308.51 g/mol, XLogP of 6.36, 15 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(3E,13Z)-octadeca-3,13-dienyl] acetate is sourced from PubChem (CID 5363259), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).