About (3E)-hexa-3,5-dien-2-ol
(3E)-hexa-3,5-dien-2-ol (PubChem CID 5363296) has the molecular formula C6H10O
and a molecular weight of 98.14 g/mol. Its IUPAC name is (3E)-hexa-3,5-dien-2-ol.
Molecular Properties
| Compound Name | (3E)-hexa-3,5-dien-2-ol |
| PubChem CID | 5363296 |
| Molecular Formula | C6H10O |
| Molecular Weight | 98.14 g/mol |
| Exact Mass | 98.07 |
| IUPAC Name | (3E)-hexa-3,5-dien-2-ol |
| SMILES | C=C/C=C/C(C)O |
| InChI | InChI=1S/C6H10O/c1-3-4-5-6(2)7/h3-7H,1H2,2H3/b5-4+ |
| InChIKey | VAOJQRMYAXTUQI-SNAWJCMRSA-N |
| XLogP | 1.11 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 98.14 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (3E)-hexa-3,5-dien-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3E)-hexa-3,5-dien-2-ol?
The IUPAC name of (3E)-hexa-3,5-dien-2-ol (CID 5363296) is (3E)-hexa-3,5-dien-2-ol.
What is the SMILES notation for (3E)-hexa-3,5-dien-2-ol?
The canonical SMILES for (3E)-hexa-3,5-dien-2-ol is C=C/C=C/C(C)O.
What is the InChIKey of (3E)-hexa-3,5-dien-2-ol?
The InChIKey is VAOJQRMYAXTUQI-SNAWJCMRSA-N. The full InChI is InChI=1S/C6H10O/c1-3-4-5-6(2)7/h3-7H,1H2,2H3/b5-4+.
What are the key properties of (3E)-hexa-3,5-dien-2-ol?
(3E)-hexa-3,5-dien-2-ol has a molecular weight of 98.14 g/mol, XLogP of 1.11, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3E)-hexa-3,5-dien-2-ol is sourced from PubChem (CID 5363296), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).