About (E)-6,6-dimethyl-5-propan-2-ylhept-3-ene-2,5-diol
(E)-6,6-dimethyl-5-propan-2-ylhept-3-ene-2,5-diol (PubChem CID 5363341) has the molecular formula C12H24O2
and a molecular weight of 200.32 g/mol. Its IUPAC name is (E)-6,6-dimethyl-5-propan-2-ylhept-3-ene-2,5-diol.
Molecular Properties
| Compound Name | (E)-6,6-dimethyl-5-propan-2-ylhept-3-ene-2,5-diol |
| PubChem CID | 5363341 |
| Molecular Formula | C12H24O2 |
| Molecular Weight | 200.32 g/mol |
| Exact Mass | 200.18 |
| IUPAC Name | (E)-6,6-dimethyl-5-propan-2-ylhept-3-ene-2,5-diol |
| SMILES | CC(O)/C=C/C(O)(C(C)C)C(C)(C)C |
| InChI | InChI=1S/C12H24O2/c1-9(2)12(14,11(4,5)6)8-7-10(3)13/h7-10,13-14H,1-6H3/b8-7+ |
| InChIKey | CAYHOJPWXZGMRX-BQYQJAHWSA-N |
| XLogP | 2.36 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.32 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (E)-6,6-dimethyl-5-propan-2-ylhept-3-ene-2,5-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-6,6-dimethyl-5-propan-2-ylhept-3-ene-2,5-diol?
The IUPAC name of (E)-6,6-dimethyl-5-propan-2-ylhept-3-ene-2,5-diol (CID 5363341) is (E)-6,6-dimethyl-5-propan-2-ylhept-3-ene-2,5-diol.
What is the SMILES notation for (E)-6,6-dimethyl-5-propan-2-ylhept-3-ene-2,5-diol?
The canonical SMILES for (E)-6,6-dimethyl-5-propan-2-ylhept-3-ene-2,5-diol is CC(O)/C=C/C(O)(C(C)C)C(C)(C)C.
What is the InChIKey of (E)-6,6-dimethyl-5-propan-2-ylhept-3-ene-2,5-diol?
The InChIKey is CAYHOJPWXZGMRX-BQYQJAHWSA-N. The full InChI is InChI=1S/C12H24O2/c1-9(2)12(14,11(4,5)6)8-7-10(3)13/h7-10,13-14H,1-6H3/b8-7+.
What are the key properties of (E)-6,6-dimethyl-5-propan-2-ylhept-3-ene-2,5-diol?
(E)-6,6-dimethyl-5-propan-2-ylhept-3-ene-2,5-diol has a molecular weight of 200.32 g/mol, XLogP of 2.36, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-6,6-dimethyl-5-propan-2-ylhept-3-ene-2,5-diol is sourced from PubChem (CID 5363341), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).