About [(11Z,13Z)-hexadeca-11,13-dienyl] acetate
[(11Z,13Z)-hexadeca-11,13-dienyl] acetate (PubChem CID 5363385) has the molecular formula C18H32O2
and a molecular weight of 280.45 g/mol. Its IUPAC name is [(11Z,13Z)-hexadeca-11,13-dienyl] acetate.
Molecular Properties
| Compound Name | [(11Z,13Z)-hexadeca-11,13-dienyl] acetate |
| PubChem CID | 5363385 |
| Molecular Formula | C18H32O2 |
| Molecular Weight | 280.45 g/mol |
| Exact Mass | 280.24 |
| IUPAC Name | [(11Z,13Z)-hexadeca-11,13-dienyl] acetate |
| SMILES | CC/C=C\C=C/CCCCCCCCCCOC(C)=O |
| InChI | InChI=1S/C18H32O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-20-18(2)19/h4-7H,3,8-17H2,1-2H3/b5-4-,7-6- |
| InChIKey | JDEZPVDDXSKIMP-RZSVFLSASA-N |
| XLogP | 5.58 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 280.45 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze [(11Z,13Z)-hexadeca-11,13-dienyl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(11Z,13Z)-hexadeca-11,13-dienyl] acetate?
The IUPAC name of [(11Z,13Z)-hexadeca-11,13-dienyl] acetate (CID 5363385) is [(11Z,13Z)-hexadeca-11,13-dienyl] acetate.
What is the SMILES notation for [(11Z,13Z)-hexadeca-11,13-dienyl] acetate?
The canonical SMILES for [(11Z,13Z)-hexadeca-11,13-dienyl] acetate is CC/C=C\C=C/CCCCCCCCCCOC(C)=O.
What is the InChIKey of [(11Z,13Z)-hexadeca-11,13-dienyl] acetate?
The InChIKey is JDEZPVDDXSKIMP-RZSVFLSASA-N. The full InChI is InChI=1S/C18H32O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-20-18(2)19/h4-7H,3,8-17H2,1-2H3/b5-4-,7-6-.
What are the key properties of [(11Z,13Z)-hexadeca-11,13-dienyl] acetate?
[(11Z,13Z)-hexadeca-11,13-dienyl] acetate has a molecular weight of 280.45 g/mol, XLogP of 5.58, 13 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(11Z,13Z)-hexadeca-11,13-dienyl] acetate is sourced from PubChem (CID 5363385), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).