C18H32O — CID 5363413
(9E)-6,10,14-trimethylpentadeca-9,13-dien-2-one (PubChem CID 5363413) has the molecular formula C18H32O and a molecular weight of 264.45 g/mol. Its IUPAC name is (9E)-6,10,14-trimethylpentadeca-9,13-dien-2-one.
| Compound Name | (9E)-6,10,14-trimethylpentadeca-9,13-dien-2-one |
|---|---|
| PubChem CID | 5363413 |
| Molecular Formula | C18H32O |
| Molecular Weight | 264.45 g/mol |
| Exact Mass | 264.25 |
| IUPAC Name | (9E)-6,10,14-trimethylpentadeca-9,13-dien-2-one |
| SMILES | CC(=O)CCCC(C)CC/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C18H32O/c1-15(2)9-6-10-16(3)11-7-12-17(4)13-8-14-18(5)19/h9,11,17H,6-8,10,12-14H2,1-5H3/b16-11+ |
| InChIKey | INPFUDIQDUQFDI-LFIBNONCSA-N |
| XLogP | 5.85 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.45 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|