C17H28O2 — CID 5363426
[(6E)-3,7,11-trimethyldodeca-1,6,10-trien-3-yl] acetate (PubChem CID 5363426) has the molecular formula C17H28O2 and a molecular weight of 264.41 g/mol. Its IUPAC name is [(6E)-3,7,11-trimethyldodeca-1,6,10-trien-3-yl] acetate.
| Compound Name | [(6E)-3,7,11-trimethyldodeca-1,6,10-trien-3-yl] acetate |
|---|---|
| PubChem CID | 5363426 |
| Molecular Formula | C17H28O2 |
| Molecular Weight | 264.41 g/mol |
| Exact Mass | 264.21 |
| IUPAC Name | [(6E)-3,7,11-trimethyldodeca-1,6,10-trien-3-yl] acetate |
| SMILES | C=CC(C)(CC/C=C(\C)CCC=C(C)C)OC(C)=O |
| InChI | InChI=1S/C17H28O2/c1-7-17(6,19-16(5)18)13-9-12-15(4)11-8-10-14(2)3/h7,10,12H,1,8-9,11,13H2,2-6H3/b15-12+ |
| InChIKey | PRNJXUQTUSFYLV-NTCAYCPXSA-N |
| XLogP | 4.97 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.41 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|