About [(2E,4E)-hexa-2,4-dienyl] acetate
[(2E,4E)-hexa-2,4-dienyl] acetate (PubChem CID 5363491) has the molecular formula C8H12O2
and a molecular weight of 140.18 g/mol. Its IUPAC name is [(2E,4E)-hexa-2,4-dienyl] acetate.
Molecular Properties
| Compound Name | [(2E,4E)-hexa-2,4-dienyl] acetate |
| PubChem CID | 5363491 |
| Molecular Formula | C8H12O2 |
| Molecular Weight | 140.18 g/mol |
| Exact Mass | 140.08 |
| IUPAC Name | [(2E,4E)-hexa-2,4-dienyl] acetate |
| SMILES | C/C=C/C=C/COC(C)=O |
| InChI | InChI=1S/C8H12O2/c1-3-4-5-6-7-10-8(2)9/h3-6H,7H2,1-2H3/b4-3+,6-5+ |
| InChIKey | PXVKYPFROMBALG-VNKDHWASSA-N |
| XLogP | 1.68 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.18 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze [(2E,4E)-hexa-2,4-dienyl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2E,4E)-hexa-2,4-dienyl] acetate?
The IUPAC name of [(2E,4E)-hexa-2,4-dienyl] acetate (CID 5363491) is [(2E,4E)-hexa-2,4-dienyl] acetate.
What is the SMILES notation for [(2E,4E)-hexa-2,4-dienyl] acetate?
The canonical SMILES for [(2E,4E)-hexa-2,4-dienyl] acetate is C/C=C/C=C/COC(C)=O.
What is the InChIKey of [(2E,4E)-hexa-2,4-dienyl] acetate?
The InChIKey is PXVKYPFROMBALG-VNKDHWASSA-N. The full InChI is InChI=1S/C8H12O2/c1-3-4-5-6-7-10-8(2)9/h3-6H,7H2,1-2H3/b4-3+,6-5+.
What are the key properties of [(2E,4E)-hexa-2,4-dienyl] acetate?
[(2E,4E)-hexa-2,4-dienyl] acetate has a molecular weight of 140.18 g/mol, XLogP of 1.68, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(2E,4E)-hexa-2,4-dienyl] acetate is sourced from PubChem (CID 5363491), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).