C17H26O3 — CID 5363607
[(2E,6E,10E)-3,7,11-trimethyl-12-oxododeca-2,6,10-trienyl] acetate (PubChem CID 5363607) has the molecular formula C17H26O3 and a molecular weight of 278.39 g/mol. Its IUPAC name is [(2E,6E,10E)-3,7,11-trimethyl-12-oxododeca-2,6,10-trienyl] acetate.
| Compound Name | [(2E,6E,10E)-3,7,11-trimethyl-12-oxododeca-2,6,10-trienyl] acetate |
|---|---|
| PubChem CID | 5363607 |
| Molecular Formula | C17H26O3 |
| Molecular Weight | 278.39 g/mol |
| Exact Mass | 278.19 |
| IUPAC Name | [(2E,6E,10E)-3,7,11-trimethyl-12-oxododeca-2,6,10-trienyl] acetate |
| SMILES | CC(=O)OC/C=C(\C)CC/C=C(\C)CC/C=C(\C)C=O |
| InChI | InChI=1S/C17H26O3/c1-14(8-6-10-16(3)13-18)7-5-9-15(2)11-12-20-17(4)19/h7,10-11,13H,5-6,8-9,12H2,1-4H3/b14-7+,15-11+,16-10+ |
| InChIKey | LRIUGFZTYQJCLE-JDDBBKIWSA-N |
| XLogP | 4.15 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.39 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|