About (E)-2-methyl-4-(1,3,3-trimethyl-7-oxabicyclo[4.1.0]heptan-2-yl)but-3-en-2-ol
(E)-2-methyl-4-(1,3,3-trimethyl-7-oxabicyclo[4.1.0]heptan-2-yl)but-3-en-2-ol (PubChem CID 5363622) has the molecular formula C14H24O2
and a molecular weight of 224.34 g/mol. Its IUPAC name is (E)-2-methyl-4-(1,3,3-trimethyl-7-oxabicyclo[4.1.0]heptan-2-yl)but-3-en-2-ol.
Molecular Properties
| Compound Name | (E)-2-methyl-4-(1,3,3-trimethyl-7-oxabicyclo[4.1.0]heptan-2-yl)but-3-en-2-ol |
| PubChem CID | 5363622 |
| Molecular Formula | C14H24O2 |
| Molecular Weight | 224.34 g/mol |
| Exact Mass | 224.18 |
| IUPAC Name | (E)-2-methyl-4-(1,3,3-trimethyl-7-oxabicyclo[4.1.0]heptan-2-yl)but-3-en-2-ol |
| SMILES | CC(C)(O)/C=C/C1C(C)(C)CCC2OC21C |
| InChI | InChI=1S/C14H24O2/c1-12(2)8-7-11-14(5,16-11)10(12)6-9-13(3,4)15/h6,9-11,15H,7-8H2,1-5H3/b9-6+ |
| InChIKey | MBVVVNCORKRYEE-RMKNXTFCSA-N |
| XLogP | 2.91 |
| TPSA | 32.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.34 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze (E)-2-methyl-4-(1,3,3-trimethyl-7-oxabicyclo[4.1.0]heptan-2-yl)but-3-en-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-2-methyl-4-(1,3,3-trimethyl-7-oxabicyclo[4.1.0]heptan-2-yl)but-3-en-2-ol?
The IUPAC name of (E)-2-methyl-4-(1,3,3-trimethyl-7-oxabicyclo[4.1.0]heptan-2-yl)but-3-en-2-ol (CID 5363622) is (E)-2-methyl-4-(1,3,3-trimethyl-7-oxabicyclo[4.1.0]heptan-2-yl)but-3-en-2-ol.
What is the SMILES notation for (E)-2-methyl-4-(1,3,3-trimethyl-7-oxabicyclo[4.1.0]heptan-2-yl)but-3-en-2-ol?
The canonical SMILES for (E)-2-methyl-4-(1,3,3-trimethyl-7-oxabicyclo[4.1.0]heptan-2-yl)but-3-en-2-ol is CC(C)(O)/C=C/C1C(C)(C)CCC2OC21C.
What is the InChIKey of (E)-2-methyl-4-(1,3,3-trimethyl-7-oxabicyclo[4.1.0]heptan-2-yl)but-3-en-2-ol?
The InChIKey is MBVVVNCORKRYEE-RMKNXTFCSA-N. The full InChI is InChI=1S/C14H24O2/c1-12(2)8-7-11-14(5,16-11)10(12)6-9-13(3,4)15/h6,9-11,15H,7-8H2,1-5H3/b9-6+.
What are the key properties of (E)-2-methyl-4-(1,3,3-trimethyl-7-oxabicyclo[4.1.0]heptan-2-yl)but-3-en-2-ol?
(E)-2-methyl-4-(1,3,3-trimethyl-7-oxabicyclo[4.1.0]heptan-2-yl)but-3-en-2-ol has a molecular weight of 224.34 g/mol, XLogP of 2.91, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-2-methyl-4-(1,3,3-trimethyl-7-oxabicyclo[4.1.0]heptan-2-yl)but-3-en-2-ol is sourced from PubChem (CID 5363622), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).