C20H36O5 — CID 5363632
(2,2-dimethyl-1,3-dioxolan-4-yl)-[2,2-dimethyl-5-[(E)-non-1-enyl]-1,3-dioxolan-4-yl]methanol (PubChem CID 5363632) has the molecular formula C20H36O5 and a molecular weight of 356.50 g/mol. Its IUPAC name is (2,2-dimethyl-1,3-dioxolan-4-yl)-[2,2-dimethyl-5-[(E)-non-1-enyl]-1,3-dioxolan-4-yl]methanol.
| Compound Name | (2,2-dimethyl-1,3-dioxolan-4-yl)-[2,2-dimethyl-5-[(E)-non-1-enyl]-1,3-dioxolan-4-yl]methanol |
|---|---|
| PubChem CID | 5363632 |
| Molecular Formula | C20H36O5 |
| Molecular Weight | 356.50 g/mol |
| Exact Mass | 356.26 |
| IUPAC Name | (2,2-dimethyl-1,3-dioxolan-4-yl)-[2,2-dimethyl-5-[(E)-non-1-enyl]-1,3-dioxolan-4-yl]methanol |
| SMILES | CCCCCCC/C=C/C1OC(C)(C)OC1C(O)C1COC(C)(C)O1 |
| InChI | InChI=1S/C20H36O5/c1-6-7-8-9-10-11-12-13-15-18(25-20(4,5)23-15)17(21)16-14-22-19(2,3)24-16/h12-13,15-18,21H,6-11,14H2,1-5H3/b13-12+ |
| InChIKey | UEPALBMZDYWIHU-OUKQBFOZSA-N |
| XLogP | 3.94 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.50 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|