About (3E)-5-hydroxy-6-methyl-5-propan-2-ylhepta-3,6-dien-2-one
(3E)-5-hydroxy-6-methyl-5-propan-2-ylhepta-3,6-dien-2-one (PubChem CID 5363637) has the molecular formula C11H18O2
and a molecular weight of 182.26 g/mol. Its IUPAC name is (3E)-5-hydroxy-6-methyl-5-propan-2-ylhepta-3,6-dien-2-one.
Molecular Properties
| Compound Name | (3E)-5-hydroxy-6-methyl-5-propan-2-ylhepta-3,6-dien-2-one |
| PubChem CID | 5363637 |
| Molecular Formula | C11H18O2 |
| Molecular Weight | 182.26 g/mol |
| Exact Mass | 182.13 |
| IUPAC Name | (3E)-5-hydroxy-6-methyl-5-propan-2-ylhepta-3,6-dien-2-one |
| SMILES | C=C(C)C(O)(/C=C/C(C)=O)C(C)C |
| InChI | InChI=1S/C11H18O2/c1-8(2)11(13,9(3)4)7-6-10(5)12/h6-7,9,13H,1H2,2-5H3/b7-6+ |
| InChIKey | WKZHTPNGJAXZIT-VOTSOKGWSA-N |
| XLogP | 2.09 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.26 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (3E)-5-hydroxy-6-methyl-5-propan-2-ylhepta-3,6-dien-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3E)-5-hydroxy-6-methyl-5-propan-2-ylhepta-3,6-dien-2-one?
The IUPAC name of (3E)-5-hydroxy-6-methyl-5-propan-2-ylhepta-3,6-dien-2-one (CID 5363637) is (3E)-5-hydroxy-6-methyl-5-propan-2-ylhepta-3,6-dien-2-one.
What is the SMILES notation for (3E)-5-hydroxy-6-methyl-5-propan-2-ylhepta-3,6-dien-2-one?
The canonical SMILES for (3E)-5-hydroxy-6-methyl-5-propan-2-ylhepta-3,6-dien-2-one is C=C(C)C(O)(/C=C/C(C)=O)C(C)C.
What is the InChIKey of (3E)-5-hydroxy-6-methyl-5-propan-2-ylhepta-3,6-dien-2-one?
The InChIKey is WKZHTPNGJAXZIT-VOTSOKGWSA-N. The full InChI is InChI=1S/C11H18O2/c1-8(2)11(13,9(3)4)7-6-10(5)12/h6-7,9,13H,1H2,2-5H3/b7-6+.
What are the key properties of (3E)-5-hydroxy-6-methyl-5-propan-2-ylhepta-3,6-dien-2-one?
(3E)-5-hydroxy-6-methyl-5-propan-2-ylhepta-3,6-dien-2-one has a molecular weight of 182.26 g/mol, XLogP of 2.09, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3E)-5-hydroxy-6-methyl-5-propan-2-ylhepta-3,6-dien-2-one is sourced from PubChem (CID 5363637), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).