C16H26O3 — CID 5363683
[1-hydroxy-3,3-dimethyl-2-[(1E)-3-methylbuta-1,3-dienyl]cyclohexyl]methyl acetate (PubChem CID 5363683) has the molecular formula C16H26O3 and a molecular weight of 266.38 g/mol. Its IUPAC name is [1-hydroxy-3,3-dimethyl-2-[(1E)-3-methylbuta-1,3-dienyl]cyclohexyl]methyl acetate.
| Compound Name | [1-hydroxy-3,3-dimethyl-2-[(1E)-3-methylbuta-1,3-dienyl]cyclohexyl]methyl acetate |
|---|---|
| PubChem CID | 5363683 |
| Molecular Formula | C16H26O3 |
| Molecular Weight | 266.38 g/mol |
| Exact Mass | 266.19 |
| IUPAC Name | [1-hydroxy-3,3-dimethyl-2-[(1E)-3-methylbuta-1,3-dienyl]cyclohexyl]methyl acetate |
| SMILES | C=C(C)/C=C/C1C(C)(C)CCCC1(O)COC(C)=O |
| InChI | InChI=1S/C16H26O3/c1-12(2)7-8-14-15(4,5)9-6-10-16(14,18)11-19-13(3)17/h7-8,14,18H,1,6,9-11H2,2-5H3/b8-7+ |
| InChIKey | MPMZWYGWZKVRGW-BQYQJAHWSA-N |
| XLogP | 3.24 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.38 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|