About 3,3-bis[(E)-but-2-enyl]pentane-2,4-dione
3,3-bis[(E)-but-2-enyl]pentane-2,4-dione (PubChem CID 5363714) has the molecular formula C13H20O2
and a molecular weight of 208.30 g/mol. Its IUPAC name is 3,3-bis[(E)-but-2-enyl]pentane-2,4-dione.
Molecular Properties
| Compound Name | 3,3-bis[(E)-but-2-enyl]pentane-2,4-dione |
| PubChem CID | 5363714 |
| Molecular Formula | C13H20O2 |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.15 |
| IUPAC Name | 3,3-bis[(E)-but-2-enyl]pentane-2,4-dione |
| SMILES | C/C=C/CC(C/C=C/C)(C(C)=O)C(C)=O |
| InChI | InChI=1S/C13H20O2/c1-5-7-9-13(11(3)14,12(4)15)10-8-6-2/h5-8H,9-10H2,1-4H3/b7-5+,8-6+ |
| InChIKey | LODVLSSLTLNEJW-KQQUZDAGSA-N |
| XLogP | 3.08 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3,3-bis[(E)-but-2-enyl]pentane-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-bis[(E)-but-2-enyl]pentane-2,4-dione?
The IUPAC name of 3,3-bis[(E)-but-2-enyl]pentane-2,4-dione (CID 5363714) is 3,3-bis[(E)-but-2-enyl]pentane-2,4-dione.
What is the SMILES notation for 3,3-bis[(E)-but-2-enyl]pentane-2,4-dione?
The canonical SMILES for 3,3-bis[(E)-but-2-enyl]pentane-2,4-dione is C/C=C/CC(C/C=C/C)(C(C)=O)C(C)=O.
What is the InChIKey of 3,3-bis[(E)-but-2-enyl]pentane-2,4-dione?
The InChIKey is LODVLSSLTLNEJW-KQQUZDAGSA-N. The full InChI is InChI=1S/C13H20O2/c1-5-7-9-13(11(3)14,12(4)15)10-8-6-2/h5-8H,9-10H2,1-4H3/b7-5+,8-6+.
What are the key properties of 3,3-bis[(E)-but-2-enyl]pentane-2,4-dione?
3,3-bis[(E)-but-2-enyl]pentane-2,4-dione has a molecular weight of 208.30 g/mol, XLogP of 3.08, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-bis[(E)-but-2-enyl]pentane-2,4-dione is sourced from PubChem (CID 5363714), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).