C14H22O2 — CID 5363759
2,2,6-trimethyl-1-[(1E)-3-methylbuta-1,3-dienyl]-7-oxabicyclo[4.1.0]heptan-3-ol (PubChem CID 5363759) has the molecular formula C14H22O2 and a molecular weight of 222.33 g/mol. Its IUPAC name is 2,2,6-trimethyl-1-[(1E)-3-methylbuta-1,3-dienyl]-7-oxabicyclo[4.1.0]heptan-3-ol.
| Compound Name | 2,2,6-trimethyl-1-[(1E)-3-methylbuta-1,3-dienyl]-7-oxabicyclo[4.1.0]heptan-3-ol |
|---|---|
| PubChem CID | 5363759 |
| Molecular Formula | C14H22O2 |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.16 |
| IUPAC Name | 2,2,6-trimethyl-1-[(1E)-3-methylbuta-1,3-dienyl]-7-oxabicyclo[4.1.0]heptan-3-ol |
| SMILES | C=C(C)/C=C/C12OC1(C)CCC(O)C2(C)C |
| InChI | InChI=1S/C14H22O2/c1-10(2)6-9-14-12(3,4)11(15)7-8-13(14,5)16-14/h6,9,11,15H,1,7-8H2,2-5H3/b9-6+ |
| InChIKey | ISUAUJDTROMBDT-RMKNXTFCSA-N |
| XLogP | 2.83 |
| TPSA | 32.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|