About Phylanthoside
Phylanthoside (PubChem CID 5363794) has the molecular formula C40H52O17
and a molecular weight of 804.84 g/mol.
Molecular Properties
| Compound Name | Phylanthoside |
| PubChem CID | 5363794 |
| Molecular Formula | C40H52O17 |
| Molecular Weight | 804.84 g/mol |
| Exact Mass | 804.32 |
| IUPAC Name | — |
| SMILES | CC(=O)OC1C(O)C(C)OC(OC2C(OC(=O)C3CCC4C(C3)OC3(CC(OC(=O)/C=C/c5ccccc5)C(C)CO3)C43CO3)OC(C)C(O)C2OC(C)=O)C1O |
| InChI | InChI=1S/C40H52O17/c1-19-17-48-40(16-28(19)54-29(43)14-11-24-9-7-6-8-10-24)39(18-49-39)26-13-12-25(15-27(26)57-40)36(47)56-38-35(34(53-23(5)42)31(45)21(3)51-38)55-37-32(46)33(52-22(4)41)30(44)20(2)50-37/h6-11,14,19-21,25-28,30-35,37-38,44-46H,12-13,15-18H2,1-5H3/b14-11+ |
| InChIKey | VOTNXJVGRXZYOA-SDNWHVSQSA-N |
| XLogP | 1.31 |
| TPSA | 224.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 57 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 804.84 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 17 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze Phylanthoside with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Phylanthoside?
The IUPAC name of Phylanthoside (CID 5363794) is not available.
What is the SMILES notation for Phylanthoside?
The canonical SMILES for Phylanthoside is CC(=O)OC1C(O)C(C)OC(OC2C(OC(=O)C3CCC4C(C3)OC3(CC(OC(=O)/C=C/c5ccccc5)C(C)CO3)C43CO3)OC(C)C(O)C2OC(C)=O)C1O.
What is the InChIKey of Phylanthoside?
The InChIKey is VOTNXJVGRXZYOA-SDNWHVSQSA-N. The full InChI is InChI=1S/C40H52O17/c1-19-17-48-40(16-28(19)54-29(43)14-11-24-9-7-6-8-10-24)39(18-49-39)26-13-12-25(15-27(26)57-40)36(47)56-38-35(34(53-23(5)42)31(45)21(3)51-38)55-37-32(46)33(52-22(4)41)30(44)20(2)50-37/h6-11,14,19-21,25-28,30-35,37-38,44-46H,12-13,15-18H2,1-5H3/b14-11+.
What are the key properties of Phylanthoside?
Phylanthoside has a molecular weight of 804.84 g/mol, XLogP of 1.31, 9 rotatable bonds, 3 hydrogen bond donors, and 17 hydrogen bond acceptors.
Where does this data come from?
All data for Phylanthoside is sourced from PubChem (CID 5363794), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).