C18H26O8 — CID 5363821
methyl (E)-4-[7-acetyloxy-2,2-dimethyl-3a-(2-oxoethyl)-4,6,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-6-yl]-3-methylbut-2-enoate (PubChem CID 5363821) has the molecular formula C18H26O8 and a molecular weight of 370.40 g/mol. Its IUPAC name is methyl (E)-4-[7-acetyloxy-2,2-dimethyl-3a-(2-oxoethyl)-4,6,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-6-yl]-3-methylbut-2-enoate.
| Compound Name | methyl (E)-4-[7-acetyloxy-2,2-dimethyl-3a-(2-oxoethyl)-4,6,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-6-yl]-3-methylbut-2-enoate |
|---|---|
| PubChem CID | 5363821 |
| Molecular Formula | C18H26O8 |
| Molecular Weight | 370.40 g/mol |
| Exact Mass | 370.16 |
| IUPAC Name | methyl (E)-4-[7-acetyloxy-2,2-dimethyl-3a-(2-oxoethyl)-4,6,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-6-yl]-3-methylbut-2-enoate |
| SMILES | COC(=O)/C=C(\C)CC1OCC2(CC=O)OC(C)(C)OC2C1OC(C)=O |
| InChI | InChI=1S/C18H26O8/c1-11(9-14(21)22-5)8-13-15(24-12(2)20)16-18(6-7-19,10-23-13)26-17(3,4)25-16/h7,9,13,15-16H,6,8,10H2,1-5H3/b11-9+ |
| InChIKey | AQYLLRLNOWQYAH-PKNBQFBNSA-N |
| XLogP | 1.31 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.40 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|