About 4-acetylcyclohexan-1-one
4-acetylcyclohexan-1-one (PubChem CID 536391) has the molecular formula C8H12O2
and a molecular weight of 140.18 g/mol. Its IUPAC name is 4-acetylcyclohexan-1-one.
Molecular Properties
| Compound Name | 4-acetylcyclohexan-1-one |
| PubChem CID | 536391 |
| Molecular Formula | C8H12O2 |
| Molecular Weight | 140.18 g/mol |
| Exact Mass | 140.08 |
| IUPAC Name | 4-acetylcyclohexan-1-one |
| SMILES | CC(=O)C1CCC(=O)CC1 |
| InChI | InChI=1S/C8H12O2/c1-6(9)7-2-4-8(10)5-3-7/h7H,2-5H2,1H3 |
| InChIKey | LGJYVZNKQBEZGD-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.18 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-acetylcyclohexan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-acetylcyclohexan-1-one?
The IUPAC name of 4-acetylcyclohexan-1-one (CID 536391) is 4-acetylcyclohexan-1-one.
What is the SMILES notation for 4-acetylcyclohexan-1-one?
The canonical SMILES for 4-acetylcyclohexan-1-one is CC(=O)C1CCC(=O)CC1.
What is the InChIKey of 4-acetylcyclohexan-1-one?
The InChIKey is LGJYVZNKQBEZGD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12O2/c1-6(9)7-2-4-8(10)5-3-7/h7H,2-5H2,1H3.
What are the key properties of 4-acetylcyclohexan-1-one?
4-acetylcyclohexan-1-one has a molecular weight of 140.18 g/mol, XLogP of 1.33, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-acetylcyclohexan-1-one is sourced from PubChem (CID 536391), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).