C33H40O11 — CID 5363973
[(1E,19Z,21E)-23-(1-acetyloxyethyl)-9,15-dimethyl-3,18-dioxospiro[4,12,17,24-tetraoxapentacyclo[21.3.1.113,16.06,11.06,15]octacosa-1,9,19,21-tetraene-14,2'-oxirane]-27-yl] acetate (PubChem CID 5363973) has the molecular formula C33H40O11 and a molecular weight of 612.67 g/mol. Its IUPAC name is [(1E,19Z,21E)-23-(1-acetyloxyethyl)-9,15-dimethyl-3,18-dioxospiro[4,12,17,24-tetraoxapentacyclo[21.3.1.113,16.06,11.06,15]octacosa-1,9,19,21-tetraene-14,2'-oxirane]-27-yl] acetate.
| Compound Name | [(1E,19Z,21E)-23-(1-acetyloxyethyl)-9,15-dimethyl-3,18-dioxospiro[4,12,17,24-tetraoxapentacyclo[21.3.1.113,16.06,11.06,15]octacosa-1,9,19,21-tetraene-14,2'-oxirane]-27-yl] acetate |
|---|---|
| PubChem CID | 5363973 |
| Molecular Formula | C33H40O11 |
| Molecular Weight | 612.67 g/mol |
| Exact Mass | 612.26 |
| IUPAC Name | [(1E,19Z,21E)-23-(1-acetyloxyethyl)-9,15-dimethyl-3,18-dioxospiro[4,12,17,24-tetraoxapentacyclo[21.3.1.113,16.06,11.06,15]octacosa-1,9,19,21-tetraene-14,2'-oxirane]-27-yl] acetate |
| SMILES | CC(=O)OC(C)C12/C=C/C=C/C(=O)OC3CC4OC5C=C(C)CCC5(COC(=O)/C=C(\CCO1)C2OC(C)=O)C3(C)C41CO1 |
| InChI | InChI=1S/C33H40O11/c1-19-9-12-31-17-38-28(37)15-23-10-13-39-32(20(2)41-21(3)34,29(23)42-22(4)35)11-7-6-8-27(36)44-24-16-26(43-25(31)14-19)33(18-40-33)30(24,31)5/h6-8,11,14-15,20,24-26,29H,9-10,12-13,16-18H2,1-5H3/b8-6+,11-7+,23-15+ |
| InChIKey | PCFSOFHNZOHJSF-RVBGJKELSA-N |
| XLogP | 3.21 |
| TPSA | 136.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.67 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|