About (Z)-1,1-diethoxyhex-3-ene
(Z)-1,1-diethoxyhex-3-ene (PubChem CID 5364291) has the molecular formula C10H20O2
and a molecular weight of 172.27 g/mol. Its IUPAC name is (Z)-1,1-diethoxyhex-3-ene.
Molecular Properties
| Compound Name | (Z)-1,1-diethoxyhex-3-ene |
| PubChem CID | 5364291 |
| Molecular Formula | C10H20O2 |
| Molecular Weight | 172.27 g/mol |
| Exact Mass | 172.15 |
| IUPAC Name | (Z)-1,1-diethoxyhex-3-ene |
| SMILES | CC/C=C\CC(OCC)OCC |
| InChI | InChI=1S/C10H20O2/c1-4-7-8-9-10(11-5-2)12-6-3/h7-8,10H,4-6,9H2,1-3H3/b8-7- |
| InChIKey | IOBHVJHSBREPFR-FPLPWBNLSA-N |
| XLogP | 2.74 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.27 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (Z)-1,1-diethoxyhex-3-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-1,1-diethoxyhex-3-ene?
The IUPAC name of (Z)-1,1-diethoxyhex-3-ene (CID 5364291) is (Z)-1,1-diethoxyhex-3-ene.
What is the SMILES notation for (Z)-1,1-diethoxyhex-3-ene?
The canonical SMILES for (Z)-1,1-diethoxyhex-3-ene is CC/C=C\CC(OCC)OCC.
What is the InChIKey of (Z)-1,1-diethoxyhex-3-ene?
The InChIKey is IOBHVJHSBREPFR-FPLPWBNLSA-N. The full InChI is InChI=1S/C10H20O2/c1-4-7-8-9-10(11-5-2)12-6-3/h7-8,10H,4-6,9H2,1-3H3/b8-7-.
What are the key properties of (Z)-1,1-diethoxyhex-3-ene?
(Z)-1,1-diethoxyhex-3-ene has a molecular weight of 172.27 g/mol, XLogP of 2.74, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-1,1-diethoxyhex-3-ene is sourced from PubChem (CID 5364291), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).