C12H20O2 — CID 5364365
(5E,9Z)-cyclododeca-5,9-diene-1,2-diol (PubChem CID 5364365) has the molecular formula C12H20O2 and a molecular weight of 196.29 g/mol. Its IUPAC name is (5E,9Z)-cyclododeca-5,9-diene-1,2-diol.
| Compound Name | (5E,9Z)-cyclododeca-5,9-diene-1,2-diol |
|---|---|
| PubChem CID | 5364365 |
| Molecular Formula | C12H20O2 |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.15 |
| IUPAC Name | (5E,9Z)-cyclododeca-5,9-diene-1,2-diol |
| SMILES | OC1CC/C=C\CC/C=C/CCC1O |
| InChI | InChI=1S/C12H20O2/c13-11-9-7-5-3-1-2-4-6-8-10-12(11)14/h3-6,11-14H,1-2,7-10H2/b5-3-,6-4+ |
| InChIKey | BHYILZSOXKSYCF-CIIODKQPSA-N |
| XLogP | 2.17 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|