About (1Z)-5,6-bis(ethenyl)cyclooctene
(1Z)-5,6-bis(ethenyl)cyclooctene (PubChem CID 5364371) has the molecular formula C12H18
and a molecular weight of 162.28 g/mol. Its IUPAC name is (1Z)-5,6-bis(ethenyl)cyclooctene.
Molecular Properties
| Compound Name | (1Z)-5,6-bis(ethenyl)cyclooctene |
| PubChem CID | 5364371 |
| Molecular Formula | C12H18 |
| Molecular Weight | 162.28 g/mol |
| Exact Mass | 162.14 |
| IUPAC Name | (1Z)-5,6-bis(ethenyl)cyclooctene |
| SMILES | C=CC1CC/C=C\CCC1C=C |
| InChI | InChI=1S/C12H18/c1-3-11-9-7-5-6-8-10-12(11)4-2/h3-6,11-12H,1-2,7-10H2/b6-5- |
| InChIKey | WWYRLKWKJBTXJY-WAYWQWQTSA-N |
| XLogP | 3.72 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.28 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (1Z)-5,6-bis(ethenyl)cyclooctene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1Z)-5,6-bis(ethenyl)cyclooctene?
The IUPAC name of (1Z)-5,6-bis(ethenyl)cyclooctene (CID 5364371) is (1Z)-5,6-bis(ethenyl)cyclooctene.
What is the SMILES notation for (1Z)-5,6-bis(ethenyl)cyclooctene?
The canonical SMILES for (1Z)-5,6-bis(ethenyl)cyclooctene is C=CC1CC/C=C\CCC1C=C.
What is the InChIKey of (1Z)-5,6-bis(ethenyl)cyclooctene?
The InChIKey is WWYRLKWKJBTXJY-WAYWQWQTSA-N. The full InChI is InChI=1S/C12H18/c1-3-11-9-7-5-6-8-10-12(11)4-2/h3-6,11-12H,1-2,7-10H2/b6-5-.
What are the key properties of (1Z)-5,6-bis(ethenyl)cyclooctene?
(1Z)-5,6-bis(ethenyl)cyclooctene has a molecular weight of 162.28 g/mol, XLogP of 3.72, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (1Z)-5,6-bis(ethenyl)cyclooctene is sourced from PubChem (CID 5364371), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).