About Stannane, tricyclohexyl-
Stannane, tricyclohexyl- (PubChem CID 5364545) has the molecular formula C18H33Sn
and a molecular weight of 368.17 g/mol.
Molecular Properties
| Compound Name | Stannane, tricyclohexyl- |
| PubChem CID | 5364545 |
| Molecular Formula | C18H33Sn |
| Molecular Weight | 368.17 g/mol |
| Exact Mass | 369.16 |
| IUPAC Name | — |
| SMILES | C1CCC([Sn](C2CCCCC2)C2CCCCC2)CC1 |
| InChI | InChI=1S/3C6H11.Sn/c3*1-2-4-6-5-3-1;/h3*1H,2-6H2; |
| InChIKey | RNVJQUPAEIQUTC-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 368.17 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze Stannane, tricyclohexyl- with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Stannane, tricyclohexyl-?
The IUPAC name of Stannane, tricyclohexyl- (CID 5364545) is not available.
What is the SMILES notation for Stannane, tricyclohexyl-?
The canonical SMILES for Stannane, tricyclohexyl- is C1CCC([Sn](C2CCCCC2)C2CCCCC2)CC1.
What is the InChIKey of Stannane, tricyclohexyl-?
The InChIKey is RNVJQUPAEIQUTC-UHFFFAOYSA-N. The full InChI is InChI=1S/3C6H11.Sn/c3*1-2-4-6-5-3-1;/h3*1H,2-6H2;.
What are the key properties of Stannane, tricyclohexyl-?
Stannane, tricyclohexyl- has a molecular weight of 368.17 g/mol, XLogP of 6.48, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for Stannane, tricyclohexyl- is sourced from PubChem (CID 5364545), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).