About (E)-hept-3-en-2-one
(E)-hept-3-en-2-one (PubChem CID 5364578) has the molecular formula C7H12O
and a molecular weight of 112.17 g/mol. Its IUPAC name is (E)-hept-3-en-2-one.
Molecular Properties
| Compound Name | (E)-hept-3-en-2-one |
| PubChem CID | 5364578 |
| Molecular Formula | C7H12O |
| Molecular Weight | 112.17 g/mol |
| Exact Mass | 112.09 |
| IUPAC Name | (E)-hept-3-en-2-one |
| SMILES | CCC/C=C/C(C)=O |
| InChI | InChI=1S/C7H12O/c1-3-4-5-6-7(2)8/h5-6H,3-4H2,1-2H3/b6-5+ |
| InChIKey | JHHZQADGLDKIPM-AATRIKPKSA-N |
| XLogP | 1.93 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 112.17 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-hept-3-en-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-hept-3-en-2-one?
The IUPAC name of (E)-hept-3-en-2-one (CID 5364578) is (E)-hept-3-en-2-one.
What is the SMILES notation for (E)-hept-3-en-2-one?
The canonical SMILES for (E)-hept-3-en-2-one is CCC/C=C/C(C)=O.
What is the InChIKey of (E)-hept-3-en-2-one?
The InChIKey is JHHZQADGLDKIPM-AATRIKPKSA-N. The full InChI is InChI=1S/C7H12O/c1-3-4-5-6-7(2)8/h5-6H,3-4H2,1-2H3/b6-5+.
What are the key properties of (E)-hept-3-en-2-one?
(E)-hept-3-en-2-one has a molecular weight of 112.17 g/mol, XLogP of 1.93, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-hept-3-en-2-one is sourced from PubChem (CID 5364578), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).