About [(Z)-tetradec-9-enyl] acetate
[(Z)-tetradec-9-enyl] acetate (PubChem CID 5364714) has the molecular formula C16H30O2
and a molecular weight of 254.41 g/mol. Its IUPAC name is [(Z)-tetradec-9-enyl] acetate.
Molecular Properties
| Compound Name | [(Z)-tetradec-9-enyl] acetate |
| PubChem CID | 5364714 |
| Molecular Formula | C16H30O2 |
| Molecular Weight | 254.41 g/mol |
| Exact Mass | 254.22 |
| IUPAC Name | [(Z)-tetradec-9-enyl] acetate |
| SMILES | CCCC/C=C\CCCCCCCCOC(C)=O |
| InChI | InChI=1S/C16H30O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-18-16(2)17/h6-7H,3-5,8-15H2,1-2H3/b7-6- |
| InChIKey | XXPBOEBNDHAAQH-SREVYHEPSA-N |
| XLogP | 5.03 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 254.41 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(Z)-tetradec-9-enyl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(Z)-tetradec-9-enyl] acetate?
The IUPAC name of [(Z)-tetradec-9-enyl] acetate (CID 5364714) is [(Z)-tetradec-9-enyl] acetate.
What is the SMILES notation for [(Z)-tetradec-9-enyl] acetate?
The canonical SMILES for [(Z)-tetradec-9-enyl] acetate is CCCC/C=C\CCCCCCCCOC(C)=O.
What is the InChIKey of [(Z)-tetradec-9-enyl] acetate?
The InChIKey is XXPBOEBNDHAAQH-SREVYHEPSA-N. The full InChI is InChI=1S/C16H30O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-18-16(2)17/h6-7H,3-5,8-15H2,1-2H3/b7-6-.
What are the key properties of [(Z)-tetradec-9-enyl] acetate?
[(Z)-tetradec-9-enyl] acetate has a molecular weight of 254.41 g/mol, XLogP of 5.03, 12 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(Z)-tetradec-9-enyl] acetate is sourced from PubChem (CID 5364714), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).