About 4-Decene, 2-methyl-, (Z)-
4-Decene, 2-methyl-, (Z)- (PubChem CID 5364884) has the molecular formula C11H22
and a molecular weight of 154.29 g/mol. Its IUPAC name is (Z)-2-methyldec-4-ene.
Molecular Properties
| Compound Name | 4-Decene, 2-methyl-, (Z)- |
| PubChem CID | 5364884 |
| Molecular Formula | C11H22 |
| Molecular Weight | 154.29 g/mol |
| Exact Mass | 154.17 |
| IUPAC Name | (Z)-2-methyldec-4-ene |
| SMILES | CCCCC/C=C\CC(C)C |
| InChI | InChI=1S/C11H22/c1-4-5-6-7-8-9-10-11(2)3/h8-9,11H,4-7,10H2,1-3H3/b9-8- |
| InChIKey | BGSRQIBGMXFMLP-HJWRWDBZSA-N |
| XLogP | 5.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | 90 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.29 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-Decene, 2-methyl-, (Z)- with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-Decene, 2-methyl-, (Z)-?
The IUPAC name of 4-Decene, 2-methyl-, (Z)- (CID 5364884) is (Z)-2-methyldec-4-ene.
What is the SMILES notation for 4-Decene, 2-methyl-, (Z)-?
The canonical SMILES for 4-Decene, 2-methyl-, (Z)- is CCCCC/C=C\CC(C)C.
What is the InChIKey of 4-Decene, 2-methyl-, (Z)-?
The InChIKey is BGSRQIBGMXFMLP-HJWRWDBZSA-N. The full InChI is InChI=1S/C11H22/c1-4-5-6-7-8-9-10-11(2)3/h8-9,11H,4-7,10H2,1-3H3/b9-8-.
What are the key properties of 4-Decene, 2-methyl-, (Z)-?
4-Decene, 2-methyl-, (Z)- has a molecular weight of 154.29 g/mol, XLogP of 5.00, 6 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4-Decene, 2-methyl-, (Z)- is sourced from PubChem (CID 5364884), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).