About methyl propane-1-sulfinate
methyl propane-1-sulfinate (PubChem CID 536502) has the molecular formula C4H10O2S
and a molecular weight of 122.19 g/mol. Its IUPAC name is methyl propane-1-sulfinate.
Molecular Properties
| Compound Name | methyl propane-1-sulfinate |
| PubChem CID | 536502 |
| Molecular Formula | C4H10O2S |
| Molecular Weight | 122.19 g/mol |
| Exact Mass | 122.04 |
| IUPAC Name | methyl propane-1-sulfinate |
| SMILES | CCCS(=O)OC |
| InChI | InChI=1S/C4H10O2S/c1-3-4-7(5)6-2/h3-4H2,1-2H3 |
| InChIKey | CMLBKHWHZQICER-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 122.19 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze methyl propane-1-sulfinate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl propane-1-sulfinate?
The IUPAC name of methyl propane-1-sulfinate (CID 536502) is methyl propane-1-sulfinate.
What is the SMILES notation for methyl propane-1-sulfinate?
The canonical SMILES for methyl propane-1-sulfinate is CCCS(=O)OC.
What is the InChIKey of methyl propane-1-sulfinate?
The InChIKey is CMLBKHWHZQICER-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10O2S/c1-3-4-7(5)6-2/h3-4H2,1-2H3.
What are the key properties of methyl propane-1-sulfinate?
methyl propane-1-sulfinate has a molecular weight of 122.19 g/mol, XLogP of 0.71, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl propane-1-sulfinate is sourced from PubChem (CID 536502), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).