C18H30O2 — CID 5365021
[(6E)-3,7,11-trimethyldodeca-1,6,10-trien-3-yl] propanoate (PubChem CID 5365021) has the molecular formula C18H30O2 and a molecular weight of 278.44 g/mol. Its IUPAC name is [(6E)-3,7,11-trimethyldodeca-1,6,10-trien-3-yl] propanoate.
| Compound Name | [(6E)-3,7,11-trimethyldodeca-1,6,10-trien-3-yl] propanoate |
|---|---|
| PubChem CID | 5365021 |
| Molecular Formula | C18H30O2 |
| Molecular Weight | 278.44 g/mol |
| Exact Mass | 278.22 |
| IUPAC Name | [(6E)-3,7,11-trimethyldodeca-1,6,10-trien-3-yl] propanoate |
| SMILES | C=CC(C)(CC/C=C(\C)CCC=C(C)C)OC(=O)CC |
| InChI | InChI=1S/C18H30O2/c1-7-17(19)20-18(6,8-2)14-10-13-16(5)12-9-11-15(3)4/h8,11,13H,2,7,9-10,12,14H2,1,3-6H3/b16-13+ |
| InChIKey | NPSBIIPKEQTFPA-DTQAZKPQSA-N |
| XLogP | 5.36 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.44 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|