C14H26O2 — CID 5365097
(2E,4E)-1,6-bis[(2-methylpropan-2-yl)oxy]hexa-2,4-diene (PubChem CID 5365097) has the molecular formula C14H26O2 and a molecular weight of 226.36 g/mol. Its IUPAC name is (2E,4E)-1,6-bis[(2-methylpropan-2-yl)oxy]hexa-2,4-diene.
| Compound Name | (2E,4E)-1,6-bis[(2-methylpropan-2-yl)oxy]hexa-2,4-diene |
|---|---|
| PubChem CID | 5365097 |
| Molecular Formula | C14H26O2 |
| Molecular Weight | 226.36 g/mol |
| Exact Mass | 226.19 |
| IUPAC Name | (2E,4E)-1,6-bis[(2-methylpropan-2-yl)oxy]hexa-2,4-diene |
| SMILES | CC(C)(C)OC/C=C/C=C/COC(C)(C)C |
| InChI | InChI=1S/C14H26O2/c1-13(2,3)15-11-9-7-8-10-12-16-14(4,5)6/h7-10H,11-12H2,1-6H3/b9-7+,10-8+ |
| InChIKey | UQVIJINYSGMKRO-FIFLTTCUSA-N |
| XLogP | 3.73 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.36 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|