About O-ethyl N-methylcarbamothioate
O-ethyl N-methylcarbamothioate (PubChem CID 5365210) has the molecular formula C4H9NOS
and a molecular weight of 119.19 g/mol. Its IUPAC name is O-ethyl N-methylcarbamothioate.
Molecular Properties
| Compound Name | O-ethyl N-methylcarbamothioate |
| PubChem CID | 5365210 |
| Molecular Formula | C4H9NOS |
| Molecular Weight | 119.19 g/mol |
| Exact Mass | 119.04 |
| IUPAC Name | O-ethyl N-methylcarbamothioate |
| SMILES | CCOC(=S)NC |
| InChI | InChI=1S/C4H9NOS/c1-3-6-4(7)5-2/h3H2,1-2H3,(H,5,7) |
| InChIKey | PTQVKYJDNZLWCR-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 119.19 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze O-ethyl N-methylcarbamothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of O-ethyl N-methylcarbamothioate?
The IUPAC name of O-ethyl N-methylcarbamothioate (CID 5365210) is O-ethyl N-methylcarbamothioate.
What is the SMILES notation for O-ethyl N-methylcarbamothioate?
The canonical SMILES for O-ethyl N-methylcarbamothioate is CCOC(=S)NC.
What is the InChIKey of O-ethyl N-methylcarbamothioate?
The InChIKey is PTQVKYJDNZLWCR-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9NOS/c1-3-6-4(7)5-2/h3H2,1-2H3,(H,5,7).
What are the key properties of O-ethyl N-methylcarbamothioate?
O-ethyl N-methylcarbamothioate has a molecular weight of 119.19 g/mol, XLogP of 0.53, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for O-ethyl N-methylcarbamothioate is sourced from PubChem (CID 5365210), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).