C18H20O8 — CID 5365359
dimethyl 1,2-bis[(E)-3-methoxy-3-oxoprop-1-enyl]tricyclo[3.1.0.02,4]hexane-3,6-dicarboxylate (PubChem CID 5365359) has the molecular formula C18H20O8 and a molecular weight of 364.35 g/mol. Its IUPAC name is dimethyl 1,2-bis[(E)-3-methoxy-3-oxoprop-1-enyl]tricyclo[3.1.0.02,4]hexane-3,6-dicarboxylate.
| Compound Name | dimethyl 1,2-bis[(E)-3-methoxy-3-oxoprop-1-enyl]tricyclo[3.1.0.02,4]hexane-3,6-dicarboxylate |
|---|---|
| PubChem CID | 5365359 |
| Molecular Formula | C18H20O8 |
| Molecular Weight | 364.35 g/mol |
| Exact Mass | 364.12 |
| IUPAC Name | dimethyl 1,2-bis[(E)-3-methoxy-3-oxoprop-1-enyl]tricyclo[3.1.0.02,4]hexane-3,6-dicarboxylate |
| SMILES | COC(=O)/C=C/C12C(C(=O)OC)C1C1C(C(=O)OC)C12/C=C/C(=O)OC |
| InChI | InChI=1S/C18H20O8/c1-23-9(19)5-7-17-11(13(17)15(21)25-3)12-14(16(22)26-4)18(12,17)8-6-10(20)24-2/h5-8,11-14H,1-4H3/b7-5+,8-6+ |
| InChIKey | UXWRJSBFGPIJJV-KQQUZDAGSA-N |
| XLogP | 0.27 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.35 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|