About (Z)-docos-13-enamide
(Z)-docos-13-enamide (PubChem CID 5365371) has the molecular formula C22H43NO
and a molecular weight of 337.59 g/mol. Its IUPAC name is (Z)-docos-13-enamide.
Molecular Properties
| Compound Name | (Z)-docos-13-enamide |
| PubChem CID | 5365371 |
| Molecular Formula | C22H43NO |
| Molecular Weight | 337.59 g/mol |
| Exact Mass | 337.33 |
| IUPAC Name | (Z)-docos-13-enamide |
| SMILES | CCCCCCCC/C=C\CCCCCCCCCCCC(N)=O |
| InChI | InChI=1S/C22H43NO/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22(23)24/h9-10H,2-8,11-21H2,1H3,(H2,23,24)/b10-9- |
| InChIKey | UAUDZVJPLUQNMU-KTKRTIGZSA-N |
| XLogP | 7.07 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 337.59 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (Z)-docos-13-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-docos-13-enamide?
The IUPAC name of (Z)-docos-13-enamide (CID 5365371) is (Z)-docos-13-enamide.
What is the SMILES notation for (Z)-docos-13-enamide?
The canonical SMILES for (Z)-docos-13-enamide is CCCCCCCC/C=C\CCCCCCCCCCCC(N)=O.
What is the InChIKey of (Z)-docos-13-enamide?
The InChIKey is UAUDZVJPLUQNMU-KTKRTIGZSA-N. The full InChI is InChI=1S/C22H43NO/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22(23)24/h9-10H,2-8,11-21H2,1H3,(H2,23,24)/b10-9-.
What are the key properties of (Z)-docos-13-enamide?
(Z)-docos-13-enamide has a molecular weight of 337.59 g/mol, XLogP of 7.07, 19 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-docos-13-enamide is sourced from PubChem (CID 5365371), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).