C15H24O4 — CID 5365405
methyl (2E,4E)-6-(2,2,5-trimethyl-1,3-dioxan-4-yl)hepta-2,4-dienoate (PubChem CID 5365405) has the molecular formula C15H24O4 and a molecular weight of 268.35 g/mol. Its IUPAC name is methyl (2E,4E)-6-(2,2,5-trimethyl-1,3-dioxan-4-yl)hepta-2,4-dienoate.
| Compound Name | methyl (2E,4E)-6-(2,2,5-trimethyl-1,3-dioxan-4-yl)hepta-2,4-dienoate |
|---|---|
| PubChem CID | 5365405 |
| Molecular Formula | C15H24O4 |
| Molecular Weight | 268.35 g/mol |
| Exact Mass | 268.17 |
| IUPAC Name | methyl (2E,4E)-6-(2,2,5-trimethyl-1,3-dioxan-4-yl)hepta-2,4-dienoate |
| SMILES | COC(=O)/C=C/C=C/C(C)C1OC(C)(C)OCC1C |
| InChI | InChI=1S/C15H24O4/c1-11(8-6-7-9-13(16)17-5)14-12(2)10-18-15(3,4)19-14/h6-9,11-12,14H,10H2,1-5H3/b8-6+,9-7+ |
| InChIKey | OEMXNHSZJZFCCX-CDJQDVQCSA-N |
| XLogP | 2.70 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.35 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|