About [(E)-2-ethoxyethenyl] acetate
[(E)-2-ethoxyethenyl] acetate (PubChem CID 5365428) has the molecular formula C6H10O3
and a molecular weight of 130.14 g/mol. Its IUPAC name is [(E)-2-ethoxyethenyl] acetate.
Molecular Properties
| Compound Name | [(E)-2-ethoxyethenyl] acetate |
| PubChem CID | 5365428 |
| Molecular Formula | C6H10O3 |
| Molecular Weight | 130.14 g/mol |
| Exact Mass | 130.06 |
| IUPAC Name | [(E)-2-ethoxyethenyl] acetate |
| SMILES | CCO/C=C/OC(C)=O |
| InChI | InChI=1S/C6H10O3/c1-3-8-4-5-9-6(2)7/h4-5H,3H2,1-2H3/b5-4+ |
| InChIKey | RDQQZSMXQAMRFQ-SNAWJCMRSA-N |
| XLogP | 1.06 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.14 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze [(E)-2-ethoxyethenyl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-2-ethoxyethenyl] acetate?
The IUPAC name of [(E)-2-ethoxyethenyl] acetate (CID 5365428) is [(E)-2-ethoxyethenyl] acetate.
What is the SMILES notation for [(E)-2-ethoxyethenyl] acetate?
The canonical SMILES for [(E)-2-ethoxyethenyl] acetate is CCO/C=C/OC(C)=O.
What is the InChIKey of [(E)-2-ethoxyethenyl] acetate?
The InChIKey is RDQQZSMXQAMRFQ-SNAWJCMRSA-N. The full InChI is InChI=1S/C6H10O3/c1-3-8-4-5-9-6(2)7/h4-5H,3H2,1-2H3/b5-4+.
What are the key properties of [(E)-2-ethoxyethenyl] acetate?
[(E)-2-ethoxyethenyl] acetate has a molecular weight of 130.14 g/mol, XLogP of 1.06, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-2-ethoxyethenyl] acetate is sourced from PubChem (CID 5365428), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).